C32H56O3Si2 — CID 146031623
(2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-2-prop-2-enylcyclopentan-1-one (PubChem CID 146031623) has the molecular formula C32H56O3Si2 and a molecular weight of 544.97 g/mol. Its IUPAC name is (2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-2-prop-2-enylcyclopentan-1-one.
| Compound Name | (2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-2-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 146031623 |
| Molecular Formula | C32H56O3Si2 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | (2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-2-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@H]1C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1c1ccc(C(CCCCC)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H56O3Si2/c1-13-15-16-18-28(34-36(9,10)31(3,4)5)24-19-21-25(22-20-24)30-26(17-14-2)27(33)23-29(30)35-37(11,12)32(6,7)8/h14,19-22,26,28-30H,2,13,15-18,23H2,1,3-12H3/t26-,28?,29-,30+/m0/s1 |
| InChIKey | UXHJDZBJPKSFLG-LHGFORMVSA-N |
| XLogP | 9.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|