C32H54O4Si — CID 58260079
methyl (Z)-7-[(1R,2S,3R,5S)-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate (PubChem CID 58260079) has the molecular formula C32H54O4Si and a molecular weight of 530.87 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3R,5S)-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3R,5S)-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58260079 |
| Molecular Formula | C32H54O4Si |
| Molecular Weight | 530.87 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3R,5S)-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)c1ccc([C@@H]2[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]2C)cc1 |
| InChI | InChI=1S/C32H54O4Si/c1-9-10-13-17-29(36-37(7,8)32(3,4)5)25-19-21-26(22-20-25)31-24(2)23-28(33)27(31)16-14-11-12-15-18-30(34)35-6/h11,14,19-22,24,27-29,31,33H,9-10,12-13,15-18,23H2,1-8H3/b14-11-/t24-,27+,28+,29?,31-/m1/s1 |
| InChIKey | DQAPSDPGHOJOBO-JMHWUPDOSA-N |
| XLogP | 8.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.87 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|