C25H37FO4 — CID 70879852
methyl (Z)-7-[(1R,3R)-5-fluoro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate (PubChem CID 70879852) has the molecular formula C25H37FO4 and a molecular weight of 420.57 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,3R)-5-fluoro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,3R)-5-fluoro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70879852 |
| Molecular Formula | C25H37FO4 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | methyl (Z)-7-[(1R,3R)-5-fluoro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(O)c1ccc(C2[C@@H](C/C=C\CCCC(=O)OC)C(F)C[C@H]2O)cc1 |
| InChI | InChI=1S/C25H37FO4/c1-3-4-7-11-22(27)18-13-15-19(16-14-18)25-20(21(26)17-23(25)28)10-8-5-6-9-12-24(29)30-2/h5,8,13-16,20-23,25,27-28H,3-4,6-7,9-12,17H2,1-2H3/b8-5-/t20-,21?,22?,23+,25?/m0/s1 |
| InChIKey | FATJUEFLJLHZRC-SXPIEYRESA-N |
| XLogP | 5.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|