C26H37NO4 — CID 143891778
methyl (Z)-7-[(1S,2S,3R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate (PubChem CID 143891778) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,2S,3R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,2S,3R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 143891778 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | methyl (Z)-7-[(1S,2S,3R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(O)c1ccc([C@H]2[C@H](O)CC(C#N)[C@@H]2C/C=C\CCCC(=O)OC)cc1 |
| InChI | InChI=1S/C26H37NO4/c1-3-4-7-11-23(28)19-13-15-20(16-14-19)26-22(21(18-27)17-24(26)29)10-8-5-6-9-12-25(30)31-2/h5,8,13-16,21-24,26,28-29H,3-4,6-7,9-12,17H2,1-2H3/b8-5-/t21?,22-,23?,24+,26+/m0/s1 |
| InChIKey | JATXTBXPZMGFRS-OVQRQBEGSA-N |
| XLogP | 5.19 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|