C25H35NO4 — CID 67155939
7-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoic acid (PubChem CID 67155939) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is 7-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67155939 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 7-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(O)c1ccc([C@@H]2[C@@H](CC=CCCCC(=O)O)[C@H](C#N)C[C@H]2O)cc1 |
| InChI | InChI=1S/C25H35NO4/c1-2-3-6-10-22(27)18-12-14-19(15-13-18)25-21(20(17-26)16-23(25)28)9-7-4-5-8-11-24(29)30/h4,7,12-15,20-23,25,27-28H,2-3,5-6,8-11,16H2,1H3,(H,29,30)/t20-,21-,22?,23+,25+/m0/s1 |
| InChIKey | XMZNXASVJYOPFE-BXSPSTCZSA-N |
| XLogP | 5.11 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|