C23H31NO3 — CID 71147967
(Z)-7-[(3R,5R)-2-(4-tert-butylphenyl)-5-cyano-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 71147967) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (Z)-7-[(3R,5R)-2-(4-tert-butylphenyl)-5-cyano-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,5R)-2-(4-tert-butylphenyl)-5-cyano-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 71147967 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (Z)-7-[(3R,5R)-2-(4-tert-butylphenyl)-5-cyano-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(C)c1ccc(C2C(C/C=C\CCCC(=O)O)[C@H](C#N)C[C@H]2O)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-23(2,3)18-12-10-16(11-13-18)22-19(17(15-24)14-20(22)25)8-6-4-5-7-9-21(26)27/h4,6,10-13,17,19-20,22,25H,5,7-9,14H2,1-3H3,(H,26,27)/b6-4-/t17-,19?,20+,22?/m0/s1 |
| InChIKey | SKJHAGLXQTTZOR-LOGGVXDCSA-N |
| XLogP | 4.79 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|