C23H33ClO4 — CID 69352692
methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]cyclopentyl]hept-5-enoate (PubChem CID 69352692) has the molecular formula C23H33ClO4 and a molecular weight of 408.97 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 69352692 |
| Molecular Formula | C23H33ClO4 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@@H]1[C@@H](c2ccc(C(C)(C)CO)cc2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C23H33ClO4/c1-23(2,15-25)17-12-10-16(11-13-17)22-18(19(24)14-20(22)26)8-6-4-5-7-9-21(27)28-3/h4,6,10-13,18-20,22,25-26H,5,7-9,14-15H2,1-3H3/t18-,19+,20+,22+/m0/s1 |
| InChIKey | FTZLQTVABVUGQA-GPQLQYNLSA-N |
| XLogP | 4.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|