C26H37ClO4 — CID 23549467
methyl (E)-7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 23549467) has the molecular formula C26H37ClO4 and a molecular weight of 449.03 g/mol. Its IUPAC name is methyl (E)-7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (E)-7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 23549467 |
| Molecular Formula | C26H37ClO4 |
| Molecular Weight | 449.03 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | methyl (E)-7-[5-chloro-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C/CC1C(Cl)CC(O)C1c1ccc(C(O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H37ClO4/c1-31-24(29)12-8-3-2-7-11-21-22(27)17-23(28)25(21)18-13-15-20(16-14-18)26(30)19-9-5-4-6-10-19/h2,7,13-16,19,21-23,25-26,28,30H,3-6,8-12,17H2,1H3/b7-2+ |
| InChIKey | XWMXWKGOQYWZNY-FARCUNLSSA-N |
| XLogP | 5.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.03 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|