C27H39ClO4 — CID 58894604
(Z)-7-[(1R,2S,5R)-5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 58894604) has the molecular formula C27H39ClO4 and a molecular weight of 463.06 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,5R)-5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,5R)-5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 58894604 |
| Molecular Formula | C27H39ClO4 |
| Molecular Weight | 463.06 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (Z)-7-[(1R,2S,5R)-5-chloro-2-[4-(3-cyclohexyl-1-hydroxypropyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H](Cl)CC(O)[C@@H]1c1ccc(C(O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H39ClO4/c28-23-18-25(30)27(22(23)10-6-1-2-7-11-26(31)32)21-15-13-20(14-16-21)24(29)17-12-19-8-4-3-5-9-19/h1,6,13-16,19,22-25,27,29-30H,2-5,7-12,17-18H2,(H,31,32)/b6-1-/t22-,23+,24?,25?,27+/m0/s1 |
| InChIKey | XXHQAVRFTQVEFZ-PZIGLHHISA-N |
| XLogP | 6.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.06 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|