C26H39ClO4 — CID 59794676
(Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methylheptan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid (PubChem CID 59794676) has the molecular formula C26H39ClO4 and a molecular weight of 451.05 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methylheptan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methylheptan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59794676 |
| Molecular Formula | C26H39ClO4 |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methylheptan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(O)C(C)(C)c1ccc([C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C26H39ClO4/c1-4-5-11-23(29)26(2,3)19-15-13-18(14-16-19)25-20(21(27)17-22(25)28)10-8-6-7-9-12-24(30)31/h6,8,13-16,20-23,25,28-29H,4-5,7,9-12,17H2,1-3H3,(H,30,31)/b8-6-/t20-,21+,22+,23?,25+/m0/s1 |
| InChIKey | GYVWVRVKFKRIBU-RTMPIPQQSA-N |
| XLogP | 5.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|