C24H34ClIO4 — CID 68862022
7-[(1R,2S,3S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-1-iodohexyl)phenyl]cyclopentyl]hept-5-enoic acid (PubChem CID 68862022) has the molecular formula C24H34ClIO4 and a molecular weight of 548.89 g/mol. Its IUPAC name is 7-[(1R,2S,3S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-1-iodohexyl)phenyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-1-iodohexyl)phenyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 68862022 |
| Molecular Formula | C24H34ClIO4 |
| Molecular Weight | 548.89 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 7-[(1R,2S,3S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-1-iodohexyl)phenyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(O)(I)c1ccc([C@@H]2[C@@H](CC=CCCCC(=O)O)[C@H](Cl)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C24H34ClIO4/c1-2-3-8-15-24(26,30)18-13-11-17(12-14-18)23-19(20(25)16-21(23)27)9-6-4-5-7-10-22(28)29/h4,6,11-14,19-21,23,27,30H,2-3,5,7-10,15-16H2,1H3,(H,28,29)/t19-,20+,21-,23+,24?/m0/s1 |
| InChIKey | KXXZZGRTMZLTBY-SHIXGPEQSA-N |
| XLogP | 6.12 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.89 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|