C24H35ClO4 — CID 67018007
7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-[(1R)-1-hydroxyhexyl]phenyl]cyclopentyl]hept-5-enoic acid (PubChem CID 67018007) has the molecular formula C24H35ClO4 and a molecular weight of 422.99 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-[(1R)-1-hydroxyhexyl]phenyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-[(1R)-1-hydroxyhexyl]phenyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67018007 |
| Molecular Formula | C24H35ClO4 |
| Molecular Weight | 422.99 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-[(1R)-1-hydroxyhexyl]phenyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC[C@@H](O)c1ccc([C@@H]2[C@@H](CC=CCCCC(=O)O)[C@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C24H35ClO4/c1-2-3-6-10-21(26)17-12-14-18(15-13-17)24-19(20(25)16-22(24)27)9-7-4-5-8-11-23(28)29/h4,7,12-15,19-22,24,26-27H,2-3,5-6,8-11,16H2,1H3,(H,28,29)/t19-,20+,21+,22+,24+/m0/s1 |
| InChIKey | ZOXKIFGUQLOEFG-YWCCWUOUSA-N |
| XLogP | 5.57 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.99 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|