C25H37ClO4 — CID 90951108
methyl 7-[(1R,2S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate (PubChem CID 90951108) has the molecular formula C25H37ClO4 and a molecular weight of 437.02 g/mol. Its IUPAC name is methyl 7-[(1R,2S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90951108 |
| Molecular Formula | C25H37ClO4 |
| Molecular Weight | 437.02 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | methyl 7-[(1R,2S,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyhexyl)phenyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(O)c1ccc([C@H]2C(O)C[C@@H](Cl)[C@@H]2CC=CCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C25H37ClO4/c1-3-4-7-11-22(27)18-13-15-19(16-14-18)25-20(21(26)17-23(25)28)10-8-5-6-9-12-24(29)30-2/h5,8,13-16,20-23,25,27-28H,3-4,6-7,9-12,17H2,1-2H3/t20-,21+,22?,23?,25+/m0/s1 |
| InChIKey | VDVYAEVVENLGLJ-COGKASTISA-N |
| XLogP | 5.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.02 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|