C27H41ClO4 — CID 68865554
methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]cyclopentyl]hept-5-enoate (PubChem CID 68865554) has the molecular formula C27H41ClO4 and a molecular weight of 465.07 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68865554 |
| Molecular Formula | C27H41ClO4 |
| Molecular Weight | 465.07 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | methyl 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxy-5,5-dimethylhexyl)phenyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@@H]1[C@@H](c2ccc(C(O)CCCC(C)(C)C)cc2)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C27H41ClO4/c1-27(2,3)17-9-11-23(29)19-13-15-20(16-14-19)26-21(22(28)18-24(26)30)10-7-5-6-8-12-25(31)32-4/h5,7,13-16,21-24,26,29-30H,6,8-12,17-18H2,1-4H3/t21-,22+,23?,24+,26+/m0/s1 |
| InChIKey | AJYOLCBTMPOTLQ-JNGBSPTRSA-N |
| XLogP | 6.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.07 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|