C26H39ClO4 — CID 68862433
methyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]hept-5-enoate (PubChem CID 68862433) has the molecular formula C26H39ClO4 and a molecular weight of 451.05 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68862433 |
| Molecular Formula | C26H39ClO4 |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(1-hydroxyheptyl)phenyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCC(O)c1ccc([C@@H]2[C@@H](C/C=C\CCCC(=O)OC)[C@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C26H39ClO4/c1-3-4-5-9-12-23(28)19-14-16-20(17-15-19)26-21(22(27)18-24(26)29)11-8-6-7-10-13-25(30)31-2/h6,8,14-17,21-24,26,28-29H,3-5,7,9-13,18H2,1-2H3/b8-6-/t21-,22+,23?,24+,26+/m0/s1 |
| InChIKey | IGSBGIVLYZHQNY-BTROZPGGSA-N |
| XLogP | 6.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|