C26H31ClO4 — CID 68864835
methyl (Z)-7-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-[hydroxy(phenyl)methyl]phenyl]cyclopentyl]hept-5-enoate (PubChem CID 68864835) has the molecular formula C26H31ClO4 and a molecular weight of 442.98 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-[hydroxy(phenyl)methyl]phenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-[hydroxy(phenyl)methyl]phenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68864835 |
| Molecular Formula | C26H31ClO4 |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-[4-[hydroxy(phenyl)methyl]phenyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](c2ccc(C(O)c3ccccc3)cc2)[C@H](O)C[C@@H]1Cl |
| InChI | InChI=1S/C26H31ClO4/c1-31-24(29)12-8-3-2-7-11-21-22(27)17-23(28)25(21)18-13-15-20(16-14-18)26(30)19-9-5-4-6-10-19/h2,4-7,9-10,13-16,21-23,25-26,28,30H,3,8,11-12,17H2,1H3/b7-2-/t21-,22-,23+,25+,26?/m0/s1 |
| InChIKey | FNPLOLLSWQKVIM-KESWISLKSA-N |
| XLogP | 5.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|