C27H41ClO4 — CID 59794691
(Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methyloctan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid (PubChem CID 59794691) has the molecular formula C27H41ClO4 and a molecular weight of 465.07 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methyloctan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methyloctan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59794691 |
| Molecular Formula | C27H41ClO4 |
| Molecular Weight | 465.07 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (Z)-7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[4-(3-hydroxy-2-methyloctan-2-yl)phenyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(O)C(C)(C)c1ccc([C@@H]2[C@@H](C/C=C\CCCC(=O)O)[C@H](Cl)C[C@H]2O)cc1 |
| InChI | InChI=1S/C27H41ClO4/c1-4-5-8-12-24(30)27(2,3)20-16-14-19(15-17-20)26-21(22(28)18-23(26)29)11-9-6-7-10-13-25(31)32/h6,9,14-17,21-24,26,29-30H,4-5,7-8,10-13,18H2,1-3H3,(H,31,32)/b9-6-/t21-,22+,23+,24?,26+/m0/s1 |
| InChIKey | OQDQAZKUWUCZNX-SSWPWSITSA-N |
| XLogP | 6.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.07 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|