C24H35ClO3 — CID 91350749
7-[(1R,2S,5R)-5-chloro-2-(4-hexylphenyl)-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91350749) has the molecular formula C24H35ClO3 and a molecular weight of 406.99 g/mol. Its IUPAC name is 7-[(1R,2S,5R)-5-chloro-2-(4-hexylphenyl)-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,5R)-5-chloro-2-(4-hexylphenyl)-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91350749 |
| Molecular Formula | C24H35ClO3 |
| Molecular Weight | 406.99 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 7-[(1R,2S,5R)-5-chloro-2-(4-hexylphenyl)-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCCc1ccc([C@H]2C(O)C[C@@H](Cl)[C@@H]2CC=CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H35ClO3/c1-2-3-4-7-10-18-13-15-19(16-14-18)24-20(21(25)17-22(24)26)11-8-5-6-9-12-23(27)28/h5,8,13-16,20-22,24,26H,2-4,6-7,9-12,17H2,1H3,(H,27,28)/t20-,21+,22?,24+/m0/s1 |
| InChIKey | QRYHJYNKNUXGAT-ZYXZECGJSA-N |
| XLogP | 6.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.99 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|