C25H38O3 — CID 123494501
7-[(2S,3R)-2-(4-hexylphenyl)-3-hydroxy-5-methylcyclopentyl]hept-5-enoic acid (PubChem CID 123494501) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 7-[(2S,3R)-2-(4-hexylphenyl)-3-hydroxy-5-methylcyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(2S,3R)-2-(4-hexylphenyl)-3-hydroxy-5-methylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 123494501 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 7-[(2S,3R)-2-(4-hexylphenyl)-3-hydroxy-5-methylcyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCCc1ccc([C@@H]2C(CC=CCCCC(=O)O)C(C)C[C@H]2O)cc1 |
| InChI | InChI=1S/C25H38O3/c1-3-4-5-8-11-20-14-16-21(17-15-20)25-22(19(2)18-23(25)26)12-9-6-7-10-13-24(27)28/h6,9,14-17,19,22-23,25-26H,3-5,7-8,10-13,18H2,1-2H3,(H,27,28)/t19?,22?,23-,25-/m1/s1 |
| InChIKey | PKYDZCPJBLLFKQ-GREHSFLPSA-N |
| XLogP | 6.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|