C26H40O2 — CID 163831108
methyl (Z)-7-[(1R,3R)-2-(4-hexylphenyl)-3-methylcyclopentyl]hept-5-enoate (PubChem CID 163831108) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,3R)-2-(4-hexylphenyl)-3-methylcyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,3R)-2-(4-hexylphenyl)-3-methylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 163831108 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | methyl (Z)-7-[(1R,3R)-2-(4-hexylphenyl)-3-methylcyclopentyl]hept-5-enoate |
| SMILES | CCCCCCc1ccc(C2[C@@H](C/C=C\CCCC(=O)OC)CC[C@H]2C)cc1 |
| InChI | InChI=1S/C26H40O2/c1-4-5-6-9-12-22-16-19-24(20-17-22)26-21(2)15-18-23(26)13-10-7-8-11-14-25(27)28-3/h7,10,16-17,19-21,23,26H,4-6,8-9,11-15,18H2,1-3H3/b10-7-/t21-,23+,26?/m1/s1 |
| InChIKey | ODSHYZMJTCGGPI-CUNWRFHLSA-N |
| XLogP | 7.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|