C27H40O5 — CID 76759021
methyl 7-[2-[4-(1-acetyloxyhexyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 76759021) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is methyl 7-[2-[4-(1-acetyloxyhexyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[2-[4-(1-acetyloxyhexyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 76759021 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | methyl 7-[2-[4-(1-acetyloxyhexyl)phenyl]-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(OC(C)=O)c1ccc(C2C(O)CCC2CC=CCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C27H40O5/c1-4-5-8-12-25(32-20(2)28)21-14-16-23(17-15-21)27-22(18-19-24(27)29)11-9-6-7-10-13-26(30)31-3/h6,9,14-17,22,24-25,27,29H,4-5,7-8,10-13,18-19H2,1-3H3 |
| InChIKey | GLGSNOOIKQPWOW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|