C27H40Cl2O4 — CID 143863355
1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexyl acetate;methyl (Z)-hept-5-enoate (PubChem CID 143863355) has the molecular formula C27H40Cl2O4 and a molecular weight of 499.52 g/mol. Its IUPAC name is 1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexyl acetate;methyl (Z)-hept-5-enoate.
| Compound Name | 1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexyl acetate;methyl (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 143863355 |
| Molecular Formula | C27H40Cl2O4 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1-[4-[(1S,2S,4S)-2,4-dichlorocyclopentyl]phenyl]hexyl acetate;methyl (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC.CCCCCC(OC(C)=O)c1ccc([C@@H]2C[C@H](Cl)C[C@@H]2Cl)cc1 |
| InChI | InChI=1S/C19H26Cl2O2.C8H14O2/c1-3-4-5-6-19(23-13(2)22)15-9-7-14(8-10-15)17-11-16(20)12-18(17)21;1-3-4-5-6-7-8(9)10-2/h7-10,16-19H,3-6,11-12H2,1-2H3;3-4H,5-7H2,1-2H3/b;4-3-/t16-,17-,18-,19?;/m0./s1 |
| InChIKey | ANMCHNLYKFJUKL-KSZYHLFWSA-N |
| XLogP | 7.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|