C27H38Cl2O4 — CID 68837167
methyl 7-[(1R,2S,3R,5R)-2-[4-(1-acetyloxyhexyl)phenyl]-3,5-dichlorocyclopentyl]hept-5-enoate (PubChem CID 68837167) has the molecular formula C27H38Cl2O4 and a molecular weight of 497.50 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R,5R)-2-[4-(1-acetyloxyhexyl)phenyl]-3,5-dichlorocyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,3R,5R)-2-[4-(1-acetyloxyhexyl)phenyl]-3,5-dichlorocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68837167 |
| Molecular Formula | C27H38Cl2O4 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | methyl 7-[(1R,2S,3R,5R)-2-[4-(1-acetyloxyhexyl)phenyl]-3,5-dichlorocyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(OC(C)=O)c1ccc([C@@H]2[C@@H](CC=CCCCC(=O)OC)[C@H](Cl)C[C@H]2Cl)cc1 |
| InChI | InChI=1S/C27H38Cl2O4/c1-4-5-8-12-25(33-19(2)30)20-14-16-21(17-15-20)27-22(23(28)18-24(27)29)11-9-6-7-10-13-26(31)32-3/h6,9,14-17,22-25,27H,4-5,7-8,10-13,18H2,1-3H3/t22-,23+,24+,25?,27+/m0/s1 |
| InChIKey | WPKWRWKQRDIMAO-DQUFUMJQSA-N |
| XLogP | 7.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|