C27H39ClO4 — CID 123304570
methyl 7-[(1R,2S,3R)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-chlorocyclopentyl]hept-5-enoate (PubChem CID 123304570) has the molecular formula C27H39ClO4 and a molecular weight of 463.06 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-chlorocyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S,3R)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-chlorocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 123304570 |
| Molecular Formula | C27H39ClO4 |
| Molecular Weight | 463.06 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | methyl 7-[(1R,2S,3R)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-chlorocyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@H](OC(C)=O)c1ccc([C@@H]2[C@@H](CC=CCCCC(=O)OC)CC[C@H]2Cl)cc1 |
| InChI | InChI=1S/C27H39ClO4/c1-4-5-8-12-25(32-20(2)29)21-14-16-23(17-15-21)27-22(18-19-24(27)28)11-9-6-7-10-13-26(30)31-3/h6,9,14-17,22,24-25,27H,4-5,7-8,10-13,18-19H2,1-3H3/t22-,24+,25+,27-/m0/s1 |
| InChIKey | XZBWXMIQUKTVGA-TUPPOGIXSA-N |
| XLogP | 7.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.06 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|