C27H39ClO4 — CID 69012837
methyl (Z)-7-[(1R,2S)-2-[4-(1-acetyloxyhexyl)phenyl]-1-chlorocyclopentyl]hept-5-enoate (PubChem CID 69012837) has the molecular formula C27H39ClO4 and a molecular weight of 463.06 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S)-2-[4-(1-acetyloxyhexyl)phenyl]-1-chlorocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S)-2-[4-(1-acetyloxyhexyl)phenyl]-1-chlorocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 69012837 |
| Molecular Formula | C27H39ClO4 |
| Molecular Weight | 463.06 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | methyl (Z)-7-[(1R,2S)-2-[4-(1-acetyloxyhexyl)phenyl]-1-chlorocyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(OC(C)=O)c1ccc([C@@H]2CCC[C@@]2(Cl)C/C=C\CCCC(=O)OC)cc1 |
| InChI | InChI=1S/C27H39ClO4/c1-4-5-8-13-25(32-21(2)29)23-17-15-22(16-18-23)24-12-11-20-27(24,28)19-10-7-6-9-14-26(30)31-3/h7,10,15-18,24-25H,4-6,8-9,11-14,19-20H2,1-3H3/b10-7-/t24-,25?,27-/m0/s1 |
| InChIKey | QGVYLSKGNFMDDH-FSNFZHBOSA-N |
| XLogP | 7.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.06 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|