C27H38O5 — CID 58316643
methyl (Z)-7-[(1R,2S)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-oxocyclopentyl]hept-5-enoate (PubChem CID 58316643) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58316643 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | methyl (Z)-7-[(1R,2S)-2-[4-[(1R)-1-acetyloxyhexyl]phenyl]-3-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@H](OC(C)=O)c1ccc([C@H]2C(=O)CC[C@@H]2C/C=C\CCCC(=O)OC)cc1 |
| InChI | InChI=1S/C27H38O5/c1-4-5-8-12-25(32-20(2)28)21-14-16-23(17-15-21)27-22(18-19-24(27)29)11-9-6-7-10-13-26(30)31-3/h6,9,14-17,22,25,27H,4-5,7-8,10-13,18-19H2,1-3H3/b9-6-/t22-,25+,27-/m0/s1 |
| InChIKey | AWOIJORKNPVXHK-WYQNFETLSA-N |
| XLogP | 6.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|