C30H49NO4Si — CID 71154768
methyl (Z)-7-[(2S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-oxopyrrolidin-2-yl]hept-5-enoate (PubChem CID 71154768) has the molecular formula C30H49NO4Si and a molecular weight of 515.81 g/mol. Its IUPAC name is methyl (Z)-7-[(2S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-oxopyrrolidin-2-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-oxopyrrolidin-2-yl]hept-5-enoate |
|---|---|
| PubChem CID | 71154768 |
| Molecular Formula | C30H49NO4Si |
| Molecular Weight | 515.81 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | methyl (Z)-7-[(2S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-oxopyrrolidin-2-yl]hept-5-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)c1ccc(N2CCC(=O)[C@@H]2C/C=C\CCCC(=O)OC)cc1 |
| InChI | InChI=1S/C30H49NO4Si/c1-8-9-12-16-28(35-36(6,7)30(2,3)4)24-18-20-25(21-19-24)31-23-22-27(32)26(31)15-13-10-11-14-17-29(33)34-5/h10,13,18-21,26,28H,8-9,11-12,14-17,22-23H2,1-7H3/b13-10-/t26-,28?/m0/s1 |
| InChIKey | HAVVUNWQUYEVRC-GLPQMDHLSA-N |
| XLogP | 7.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.81 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|