C37H65FO4Si2 — CID 146027800
methyl (Z)-7-[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-fluorocyclopentyl]hept-5-enoate (PubChem CID 146027800) has the molecular formula C37H65FO4Si2 and a molecular weight of 649.09 g/mol. Its IUPAC name is methyl (Z)-7-[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-fluorocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-fluorocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 146027800 |
| Molecular Formula | C37H65FO4Si2 |
| Molecular Weight | 649.09 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | methyl (Z)-7-[(2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-5-fluorocyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)c1ccc([C@@H]2C(C/C=C\CCCC(=O)OC)[C@H](F)C[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H65FO4Si2/c1-13-14-17-21-32(41-43(9,10)36(2,3)4)28-23-25-29(26-24-28)35-30(20-18-15-16-19-22-34(39)40-8)31(38)27-33(35)42-44(11,12)37(5,6)7/h15,18,23-26,30-33,35H,13-14,16-17,19-22,27H2,1-12H3/b18-15-/t30?,31-,32?,33+,35-/m1/s1 |
| InChIKey | GRAMJSJDNBNXSP-AYIALDIYSA-N |
| XLogP | 11.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.09 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|