C31H53NO6SSi — CID 90935603
methyl 7-[(2S,3S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-methylsulfonyloxypyrrolidin-2-yl]hept-5-enoate (PubChem CID 90935603) has the molecular formula C31H53NO6SSi and a molecular weight of 595.92 g/mol. Its IUPAC name is methyl 7-[(2S,3S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-methylsulfonyloxypyrrolidin-2-yl]hept-5-enoate.
| Compound Name | methyl 7-[(2S,3S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-methylsulfonyloxypyrrolidin-2-yl]hept-5-enoate |
|---|---|
| PubChem CID | 90935603 |
| Molecular Formula | C31H53NO6SSi |
| Molecular Weight | 595.92 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | methyl 7-[(2S,3S)-1-[4-[1-[tert-butyl(dimethyl)silyl]oxyhexyl]phenyl]-3-methylsulfonyloxypyrrolidin-2-yl]hept-5-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)c1ccc(N2CC[C@H](OS(C)(=O)=O)[C@@H]2CC=CCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C31H53NO6SSi/c1-9-10-13-17-28(38-40(7,8)31(2,3)4)25-19-21-26(22-20-25)32-24-23-29(37-39(6,34)35)27(32)16-14-11-12-15-18-30(33)36-5/h11,14,19-22,27-29H,9-10,12-13,15-18,23-24H2,1-8H3/t27-,28?,29-/m0/s1 |
| InChIKey | AYNQNQJRQASROE-QBGWAWDMSA-N |
| XLogP | 7.54 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.92 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|