C30H54ClNO3Si — CID 66993378
methyl (Z)-7-[(2R,3R)-1-[4-[tert-butyl(dimethyl)silyl]oxy-4-[1-(cyclopropylmethyl)cyclobutyl]butyl]-3-chloropyrrolidin-2-yl]hept-5-enoate (PubChem CID 66993378) has the molecular formula C30H54ClNO3Si and a molecular weight of 540.31 g/mol. Its IUPAC name is methyl (Z)-7-[(2R,3R)-1-[4-[tert-butyl(dimethyl)silyl]oxy-4-[1-(cyclopropylmethyl)cyclobutyl]butyl]-3-chloropyrrolidin-2-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2R,3R)-1-[4-[tert-butyl(dimethyl)silyl]oxy-4-[1-(cyclopropylmethyl)cyclobutyl]butyl]-3-chloropyrrolidin-2-yl]hept-5-enoate |
|---|---|
| PubChem CID | 66993378 |
| Molecular Formula | C30H54ClNO3Si |
| Molecular Weight | 540.31 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | methyl (Z)-7-[(2R,3R)-1-[4-[tert-butyl(dimethyl)silyl]oxy-4-[1-(cyclopropylmethyl)cyclobutyl]butyl]-3-chloropyrrolidin-2-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@H](Cl)CCN1CCCC(O[Si](C)(C)C(C)(C)C)C1(CC2CC2)CCC1 |
| InChI | InChI=1S/C30H54ClNO3Si/c1-29(2,3)36(5,6)35-27(30(19-12-20-30)23-24-16-17-24)14-11-21-32-22-18-25(31)26(32)13-9-7-8-10-15-28(33)34-4/h7,9,24-27H,8,10-23H2,1-6H3/b9-7-/t25-,26-,27?/m1/s1 |
| InChIKey | UWDVVHBBJFTNBH-LKSKWELRSA-N |
| XLogP | 8.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.31 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|