C21H36ClNO3 — CID 10172769
(Z)-7-[(2S,3R)-3-chloro-1-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]pyrrolidin-2-yl]hept-5-enoic acid (PubChem CID 10172769) has the molecular formula C21H36ClNO3 and a molecular weight of 385.98 g/mol. Its IUPAC name is (Z)-7-[(2S,3R)-3-chloro-1-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]pyrrolidin-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2S,3R)-3-chloro-1-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]pyrrolidin-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10172769 |
| Molecular Formula | C21H36ClNO3 |
| Molecular Weight | 385.98 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (Z)-7-[(2S,3R)-3-chloro-1-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]pyrrolidin-2-yl]hept-5-enoic acid |
| SMILES | CCC1(C(O)CCCN2CC[C@@H](Cl)[C@@H]2C/C=C\CCCC(=O)O)CCC1 |
| InChI | InChI=1S/C21H36ClNO3/c1-2-21(13-8-14-21)19(24)10-7-15-23-16-12-17(22)18(23)9-5-3-4-6-11-20(25)26/h3,5,17-19,24H,2,4,6-16H2,1H3,(H,25,26)/b5-3-/t17-,18+,19?/m1/s1 |
| InChIKey | ZUBWYRGWYZPOJG-ZYBDUAIHSA-N |
| XLogP | 4.59 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|