C22H39ClO4 — CID 59956958
7-[(1R,2R)-5-chloro-2-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]-3-hydroxycyclopentyl]heptanoic acid (PubChem CID 59956958) has the molecular formula C22H39ClO4 and a molecular weight of 403.00 g/mol. Its IUPAC name is 7-[(1R,2R)-5-chloro-2-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]-3-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-5-chloro-2-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]-3-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59956958 |
| Molecular Formula | C22H39ClO4 |
| Molecular Weight | 403.00 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 7-[(1R,2R)-5-chloro-2-[4-(1-ethylcyclobutyl)-4-hydroxybutyl]-3-hydroxycyclopentyl]heptanoic acid |
| SMILES | CCC1(C(O)CCC[C@H]2C(O)CC(Cl)[C@@H]2CCCCCCC(=O)O)CCC1 |
| InChI | InChI=1S/C22H39ClO4/c1-2-22(13-8-14-22)20(25)11-7-10-17-16(18(23)15-19(17)24)9-5-3-4-6-12-21(26)27/h16-20,24-25H,2-15H2,1H3,(H,26,27)/t16-,17-,18?,19?,20?/m1/s1 |
| InChIKey | YAHCGGJRPSSPRF-ZNAQVQAOSA-N |
| XLogP | 5.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|