C13H23ClO4 — CID 58378741
7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]heptanoic acid (PubChem CID 58378741) has the molecular formula C13H23ClO4 and a molecular weight of 278.78 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58378741 |
| Molecular Formula | C13H23ClO4 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 7-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CO)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C13H23ClO4/c14-11-7-12(16)10(8-15)9(11)5-3-1-2-4-6-13(17)18/h9-12,15-16H,1-8H2,(H,17,18)/t9-,10-,11-,12-/m1/s1 |
| InChIKey | JSZIDOXIIKEBFA-DDHJBXDOSA-N |
| XLogP | 2.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|