C20H33ClN2O5 — CID 88855144
7-[(1R,2R,3S,5R)-5-chloro-2-[(E,3S,7R)-3,7-dinitrosooct-1-enyl]-3-hydroxycyclopentyl]heptanoic acid (PubChem CID 88855144) has the molecular formula C20H33ClN2O5 and a molecular weight of 416.95 g/mol. Its IUPAC name is 7-[(1R,2R,3S,5R)-5-chloro-2-[(E,3S,7R)-3,7-dinitrosooct-1-enyl]-3-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3S,5R)-5-chloro-2-[(E,3S,7R)-3,7-dinitrosooct-1-enyl]-3-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 88855144 |
| Molecular Formula | C20H33ClN2O5 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 7-[(1R,2R,3S,5R)-5-chloro-2-[(E,3S,7R)-3,7-dinitrosooct-1-enyl]-3-hydroxycyclopentyl]heptanoic acid |
| SMILES | C[C@H](CCC[C@@H](/C=C/[C@@H]1[C@@H](CCCCCCC(=O)O)[C@H](Cl)C[C@@H]1O)N=O)N=O |
| InChI | InChI=1S/C20H33ClN2O5/c1-14(22-27)7-6-8-15(23-28)11-12-17-16(18(21)13-19(17)24)9-4-2-3-5-10-20(25)26/h11-12,14-19,24H,2-10,13H2,1H3,(H,25,26)/b12-11+/t14-,15+,16-,17-,18-,19+/m1/s1 |
| InChIKey | GMCAPTNNOKWJQE-KHYYEIERSA-N |
| XLogP | 5.03 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|