C21H35F3O5 — CID 70987399
7-[(1R,2R,3R,5R)-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-(trifluoromethyl)cyclopentyl]heptanoic acid (PubChem CID 70987399) has the molecular formula C21H35F3O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-(trifluoromethyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-(trifluoromethyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70987399 |
| Molecular Formula | C21H35F3O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-2-[(E,3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-(trifluoromethyl)cyclopentyl]heptanoic acid |
| SMILES | C[C@@H](O)CCC[C@H](O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)O)[C@H](C(F)(F)F)C[C@H]1O |
| InChI | InChI=1S/C21H35F3O5/c1-14(25)7-6-8-15(26)11-12-17-16(9-4-2-3-5-10-20(28)29)18(13-19(17)27)21(22,23)24/h11-12,14-19,25-27H,2-10,13H2,1H3,(H,28,29)/b12-11+/t14-,15+,16-,17-,18-,19-/m1/s1 |
| InChIKey | PRZXMWLAWUFOJJ-UZMOGYDDSA-N |
| XLogP | 4.06 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|