C19H27ClO4 — CID 67528478
7-[(1R,5R)-5-chloro-3-hydroxy-2-(phenoxymethyl)cyclopentyl]heptanoic acid (PubChem CID 67528478) has the molecular formula C19H27ClO4 and a molecular weight of 354.87 g/mol. Its IUPAC name is 7-[(1R,5R)-5-chloro-3-hydroxy-2-(phenoxymethyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,5R)-5-chloro-3-hydroxy-2-(phenoxymethyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 67528478 |
| Molecular Formula | C19H27ClO4 |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 7-[(1R,5R)-5-chloro-3-hydroxy-2-(phenoxymethyl)cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(COc2ccccc2)C(O)C[C@H]1Cl |
| InChI | InChI=1S/C19H27ClO4/c20-17-12-18(21)16(13-24-14-8-4-3-5-9-14)15(17)10-6-1-2-7-11-19(22)23/h3-5,8-9,15-18,21H,1-2,6-7,10-13H2,(H,22,23)/t15-,16?,17-,18?/m1/s1 |
| InChIKey | SUNPIUXQRKINCL-RZZCCWGQSA-N |
| XLogP | 4.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|