C20H30O4 — CID 143261528
7-[(3R,4S)-4-(phenoxymethyl)oxepan-3-yl]heptanoic acid (PubChem CID 143261528) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(phenoxymethyl)oxepan-3-yl]heptanoic acid.
| Compound Name | 7-[(3R,4S)-4-(phenoxymethyl)oxepan-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 143261528 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 7-[(3R,4S)-4-(phenoxymethyl)oxepan-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1COCCC[C@@H]1COc1ccccc1 |
| InChI | InChI=1S/C20H30O4/c21-20(22)13-7-2-1-4-9-17-15-23-14-8-10-18(17)16-24-19-11-5-3-6-12-19/h3,5-6,11-12,17-18H,1-2,4,7-10,13-16H2,(H,21,22)/t17-,18+/m0/s1 |
| InChIKey | FOTJLKPSKYJTTH-ZWKOTPCHSA-N |
| XLogP | 4.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|