C27H44O4 — CID 157086332
(Z)-octadec-9-enoic acid;2-(phenoxymethyl)oxirane (PubChem CID 157086332) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (Z)-octadec-9-enoic acid;2-(phenoxymethyl)oxirane.
| Compound Name | (Z)-octadec-9-enoic acid;2-(phenoxymethyl)oxirane |
|---|---|
| PubChem CID | 157086332 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (Z)-octadec-9-enoic acid;2-(phenoxymethyl)oxirane |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C18H34O2.C9H10O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-4-8(5-3-1)10-6-9-7-11-9/h9-10H,2-8,11-17H2,1H3,(H,19,20);1-5,9H,6-7H2/b10-9-; |
| InChIKey | AECXTXLCRLEUBD-KVVVOXFISA-N |
| XLogP | 7.57 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|