C18H24O4 — CID 70488027
(Z)-7-[(3R,4S)-4-(phenoxymethyl)oxolan-3-yl]hept-5-enoic acid (PubChem CID 70488027) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (Z)-7-[(3R,4S)-4-(phenoxymethyl)oxolan-3-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,4S)-4-(phenoxymethyl)oxolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70488027 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (Z)-7-[(3R,4S)-4-(phenoxymethyl)oxolan-3-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1COC[C@H]1COc1ccccc1 |
| InChI | InChI=1S/C18H24O4/c19-18(20)11-7-2-1-4-8-15-12-21-13-16(15)14-22-17-9-5-3-6-10-17/h1,3-6,9-10,15-16H,2,7-8,11-14H2,(H,19,20)/b4-1-/t15-,16-/m0/s1 |
| InChIKey | OJSAXTWTQZEATJ-NCXMYIIMSA-N |
| XLogP | 3.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|