C19H32O4 — CID 70399564
7-[(3R,4S)-4-[2-(cyclopentylmethoxy)ethyl]oxolan-3-yl]hept-5-enoic acid (PubChem CID 70399564) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 7-[(3R,4S)-4-[2-(cyclopentylmethoxy)ethyl]oxolan-3-yl]hept-5-enoic acid.
| Compound Name | 7-[(3R,4S)-4-[2-(cyclopentylmethoxy)ethyl]oxolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70399564 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 7-[(3R,4S)-4-[2-(cyclopentylmethoxy)ethyl]oxolan-3-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1COC[C@H]1CCOCC1CCCC1 |
| InChI | InChI=1S/C19H32O4/c20-19(21)10-4-2-1-3-9-17-14-23-15-18(17)11-12-22-13-16-7-5-6-8-16/h1,3,16-18H,2,4-15H2,(H,20,21)/t17-,18+/m0/s1 |
| InChIKey | QADXXKZRIICVRE-ZWKOTPCHSA-N |
| XLogP | 4.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|