C17H28O4 — CID 54555946
7-[(3R,4S)-4-(pent-2-enoxymethyl)oxolan-3-yl]hept-5-enoic acid (PubChem CID 54555946) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(pent-2-enoxymethyl)oxolan-3-yl]hept-5-enoic acid.
| Compound Name | 7-[(3R,4S)-4-(pent-2-enoxymethyl)oxolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54555946 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 7-[(3R,4S)-4-(pent-2-enoxymethyl)oxolan-3-yl]hept-5-enoic acid |
| SMILES | CCC=CCOC[C@@H]1COC[C@@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C17H28O4/c1-2-3-8-11-20-13-16-14-21-12-15(16)9-6-4-5-7-10-17(18)19/h3-4,6,8,15-16H,2,5,7,9-14H2,1H3,(H,18,19)/t15-,16+/m0/s1 |
| InChIKey | ZNEKWZVZOJVQHY-JKSUJKDBSA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|