C19H26O6S — CID 88704163
(Z)-7-[(3R,4S)-4-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl]hept-5-enoic acid (PubChem CID 88704163) has the molecular formula C19H26O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is (Z)-7-[(3R,4S)-4-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,4S)-4-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88704163 |
| Molecular Formula | C19H26O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (Z)-7-[(3R,4S)-4-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl]hept-5-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2COC[C@@H]2C/C=C\CCCC(=O)O)cc1 |
| InChI | InChI=1S/C19H26O6S/c1-15-8-10-18(11-9-15)26(22,23)25-14-17-13-24-12-16(17)6-4-2-3-5-7-19(20)21/h2,4,8-11,16-17H,3,5-7,12-14H2,1H3,(H,20,21)/b4-2-/t16-,17-/m0/s1 |
| InChIKey | LDHVVBGLPGWAIH-OLPJUOKLSA-N |
| XLogP | 3.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|