C17H24O6S — CID 175838475
(5R)-5-methoxy-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]pentanoic acid (PubChem CID 175838475) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is (5R)-5-methoxy-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]pentanoic acid.
| Compound Name | (5R)-5-methoxy-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]pentanoic acid |
|---|---|
| PubChem CID | 175838475 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (5R)-5-methoxy-5-[(1R,2R)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]pentanoic acid |
| SMILES | CO[C@H](CCCC(=O)O)[C@@H]1C[C@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O6S/c1-12-6-8-14(9-7-12)24(20,21)23-11-13-10-15(13)16(22-2)4-3-5-17(18)19/h6-9,13,15-16H,3-5,10-11H2,1-2H3,(H,18,19)/t13-,15+,16+/m0/s1 |
| InChIKey | LJVABKZMYVQUQS-NUEKZKHPSA-N |
| XLogP | 2.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|