C21H28O6S — CID 54491700
7-[(1S,2S,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54491700) has the molecular formula C21H28O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is 7-[(1S,2S,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2S,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54491700 |
| Molecular Formula | C21H28O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 7-[(1S,2S,3S,4R)-3-[(4-methylphenyl)sulfonyloxymethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2[C@H](CC=CCCCC(=O)O)[C@@H]3CC[C@H]2O3)cc1 |
| InChI | InChI=1S/C21H28O6S/c1-15-8-10-16(11-9-15)28(24,25)26-14-18-17(19-12-13-20(18)27-19)6-4-2-3-5-7-21(22)23/h2,4,8-11,17-20H,3,5-7,12-14H2,1H3,(H,22,23)/t17-,18+,19-,20+/m0/s1 |
| InChIKey | XWEJOHCXAUMYHY-ZGXWSNOMSA-N |
| XLogP | 3.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|