C22H29NO5S — CID 54364479
7-[3-[2-(3-methylphenyl)ethenylsulfonylamino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54364479) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is 7-[3-[2-(3-methylphenyl)ethenylsulfonylamino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[3-[2-(3-methylphenyl)ethenylsulfonylamino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54364479 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 7-[3-[2-(3-methylphenyl)ethenylsulfonylamino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | Cc1cccc(C=CS(=O)(=O)NC2C3CCC(O3)C2CC=CCCCC(=O)O)c1 |
| InChI | InChI=1S/C22H29NO5S/c1-16-7-6-8-17(15-16)13-14-29(26,27)23-22-18(19-11-12-20(22)28-19)9-4-2-3-5-10-21(24)25/h2,4,6-8,13-15,18-20,22-23H,3,5,9-12H2,1H3,(H,24,25) |
| InChIKey | UOUSIDMUCUEZTP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|