C23H31NO4S — CID 18798057
(E)-6-[3-[[[(E)-2-(3-methylphenyl)ethenyl]sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid (PubChem CID 18798057) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is (E)-6-[3-[[[(E)-2-(3-methylphenyl)ethenyl]sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid.
| Compound Name | (E)-6-[3-[[[(E)-2-(3-methylphenyl)ethenyl]sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 18798057 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (E)-6-[3-[[[(E)-2-(3-methylphenyl)ethenyl]sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
| SMILES | Cc1cccc(/C=C/S(=O)(=O)NCC2C3CCC(C3)C2/C=C/CCCC(=O)O)c1 |
| InChI | InChI=1S/C23H31NO4S/c1-17-6-5-7-18(14-17)12-13-29(27,28)24-16-22-20-11-10-19(15-20)21(22)8-3-2-4-9-23(25)26/h3,5-8,12-14,19-22,24H,2,4,9-11,15-16H2,1H3,(H,25,26)/b8-3+,13-12+ |
| InChIKey | UWMUIGMBKVDPNT-PJGOPNSOSA-N |
| XLogP | 4.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|