C20H25F2NO4S — CID 142042416
(Z)-6-[(1R,2R,3S,4S)-3-[[(2,5-difluorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid (PubChem CID 142042416) has the molecular formula C20H25F2NO4S and a molecular weight of 413.49 g/mol. Its IUPAC name is (Z)-6-[(1R,2R,3S,4S)-3-[[(2,5-difluorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,2R,3S,4S)-3-[[(2,5-difluorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 142042416 |
| Molecular Formula | C20H25F2NO4S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (Z)-6-[(1R,2R,3S,4S)-3-[[(2,5-difluorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1CNS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H25F2NO4S/c21-15-8-9-18(22)19(11-15)28(26,27)23-12-17-14-7-6-13(10-14)16(17)4-2-1-3-5-20(24)25/h2,4,8-9,11,13-14,16-17,23H,1,3,5-7,10,12H2,(H,24,25)/b4-2-/t13-,14+,16+,17+/m1/s1 |
| InChIKey | OVBBROFWIPJBQA-ALFBVNKKSA-N |
| XLogP | 3.72 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|