C22H27Cl3O2 — CID 91255961
(Z)-6-[(1R,2R,3S,4S)-3-[3-(2,4,6-trichlorophenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid (PubChem CID 91255961) has the molecular formula C22H27Cl3O2 and a molecular weight of 429.82 g/mol. Its IUPAC name is (Z)-6-[(1R,2R,3S,4S)-3-[3-(2,4,6-trichlorophenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,2R,3S,4S)-3-[3-(2,4,6-trichlorophenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 91255961 |
| Molecular Formula | C22H27Cl3O2 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (Z)-6-[(1R,2R,3S,4S)-3-[3-(2,4,6-trichlorophenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1CCCc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C22H27Cl3O2/c23-16-12-20(24)19(21(25)13-16)7-4-6-18-15-10-9-14(11-15)17(18)5-2-1-3-8-22(26)27/h2,5,12-15,17-18H,1,3-4,6-11H2,(H,26,27)/b5-2-/t14-,15+,17+,18+/m1/s1 |
| InChIKey | XIKLSAFZJSUFFC-QSQKHHBTSA-N |
| XLogP | 7.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|