C15H22O3 — CID 88676999
(Z)-7-(3-formyl-2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid (PubChem CID 88676999) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (Z)-7-(3-formyl-2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid.
| Compound Name | (Z)-7-(3-formyl-2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid |
|---|---|
| PubChem CID | 88676999 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (Z)-7-(3-formyl-2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid |
| SMILES | O=CC1C2CCC(C2)C1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C15H22O3/c16-10-14-12-8-7-11(9-12)13(14)5-3-1-2-4-6-15(17)18/h1,3,10-14H,2,4-9H2,(H,17,18)/b3-1- |
| InChIKey | AKZRWACFTQKCIR-IWQZZHSRSA-N |
| XLogP | 3.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|