C14H22O2 — CID 70511264
(Z)-7-(2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid (PubChem CID 70511264) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (Z)-7-(2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid.
| Compound Name | (Z)-7-(2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid |
|---|---|
| PubChem CID | 70511264 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (Z)-7-(2-bicyclo[2.2.1]heptanyl)hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CC1CC2CCC1C2 |
| InChI | InChI=1S/C14H22O2/c15-14(16)6-4-2-1-3-5-12-9-11-7-8-13(12)10-11/h1,3,11-13H,2,4-10H2,(H,15,16)/b3-1- |
| InChIKey | DFHIBVHEBYSXSD-IWQZZHSRSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|